| Identification | |
| Name: | 2,8,9-Trioxa-5-aza-1-silabicyclo[3.3.3]undecane,1-ethoxy- |
| Synonyms: | Ethanol,2,2',2''-nitrilotri-, cyclic ethyl silicate (6CI); Silicic acid, cyclicnitrilotriethylene ethyl ester (7CI); Ethanol, 2,2',2''-nitrilotri-, cyclicester with silicic acid (H4SiO4) ethyl ester (8CI); Silicic acid (H4SiO4),ethyl ester, cyclic ester with 2,2',2''-nitrilotriethanol (8CI);1-Ethoxysilatrane; Ethoxysilatrane; Migugen; Silicic acid (H4SiO4), cyclicnitrilotriethylene ethyl ester |
| CAS: | 3463-21-6 |
| EINECS: | 222-413-7 |
| Molecular Formula: | C8H17 N O4 Si |
| Molecular Weight: | 219.35 |
| InChI: | InChI=1/C8H17NO4Si/c1-2-10-14-11-6-3-9(4-7-12-14)5-8-13-14/h2-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 100°C |
| Flash Point: | 110.4°C |
| Boiling Point: | 180°C 0,6mm |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.483 |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 110.4°C |
| Safety Data | |
 |
|
