| Identification | |
| Name: | 2-Propenoic acid,3-(4-iodophenyl)- |
| Synonyms: | Cinnamicacid, p-iodo- (7CI);p-Iodocinnamic acid; |
| CAS: | 34633-09-5 |
| Molecular Formula: | C9H7IO2 |
| Molecular Weight: | 274.06 |
| InChI: | InChI=1/C9H7IO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.862 g/cm3 |
| Refractive index: | 1.696 |
| Specification: |
The 4-Iodocinnamic acid , its cas register number is 34633-09-5. The Systematic name about this chemicals is (2E)-3-(4-iodophenyl)prop-2-enoic acid .Following are the physical and chemical properties about it: (1)Index of Refraction: 1.696 (2)Molar Refractivity: 56.61 cm3 (3)Molar Volume: 147.1 cm3 (4)Surface Tension: 58.9 dyne/cm (5)Enthalpy of Vaporization: 64.14 kJ/mol (6)Vapour Pressure: 7.13E-06 mmHg at 25 °C . It belongs to the following product categories, such as Aromatic Cinnamic Acids, Esters and Derivatives, Acids & Esters and Iodine Compounds. This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
