| Identification | |
| Name: | 2-Butanone,3-(methylthio)-, O-[(methylamino)carbonyl]oxime |
| Synonyms: | 3-(Methylthio)-2-butanoneO-(methylcarbamoyl)oxime; Butocarboxim; Co 755; Drawin; Drawin 50; Drawin 755 |
| CAS: | 34681-10-2 |
| EINECS: | 252-139-3 |
| Molecular Formula: | C7H14 N2 O2 S |
| Molecular Weight: | 190.29 |
| InChI: | InChI=1S/C7H14N2O2S/c1-5(6(2)12-4)9-11-7(10)8-3/h6H,1-4H3,(H,8,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2757 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.504 |
| Solubility: | Soluble in most organic solvents. Completely miscible with aromatic hydrocarbons, esters, and ketones. Low solubility in aliphatic hydrocarbons (11 g/l) and carbon tetrachloride. In water, 35 g/l @ 20 deg C |
| Specification: |
Butocarboxim ,its cas register number is 34681-10-2. It also can be called 2-Butanone, 3-(methylthio)-, O-(N-methylcarbamoyl)oxime . |
| Packinggroup: | III |
| Flash Point: | °C |
| Color: | Pale brown, viscous liquid (tech.). Crystalline at lower temperatures. /Technical butocarboxim/ |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
