Identification |
Name: | 2,7-Dimethoxynaphthalene |
Synonyms: | NSC 28991;Naphthalene, 2,7-dimethoxy-; |
CAS: | 3469-26-9 |
EINECS: | 222-433-6 |
Molecular Formula: | C12H12O2 |
Molecular Weight: | 188.22 |
InChI: | InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Density: | 1.097 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.584 |
Water Solubility: | AUTOIGNITION |
Solubility: | AUTOIGNITION |
Appearance: | grey to brown powder |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
|
|
 |