| Identification |
| Name: | 2,3'-Bipyridine,3,4,5,6-tetrahydro- |
| Synonyms: | Anabaseine |
| CAS: | 3471-05-4 |
| Molecular Formula: | C10H12 N2 |
| Molecular Weight: | 160.24 |
| InChI: | InChI=1/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8H,1-2,5,7H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 113.4°C |
| Boiling Point: | 263.9°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.596 |
| Flash Point: | 113.4°C |
| Usage: | A naturally occurring neurotoxin produced by hoplonemertine sea worms competes with the natural neurotransmitter acetylcholine when binding to nicotinic receptor sites. |
| Safety Data |
| |
 |
