| Identification |
| Name: | 1H-Indole-3-aceticacid, 5-methoxy- |
| Synonyms: | Indole-3-aceticacid, 5-methoxy- (6CI,7CI,8CI);(5-Methoxy-1H-indol-3-yl)acetic acid;2-(5-Methoxy-1H-indol-3-yl)acetic acid;2-(5-Methoxy-3-indolyl)acetic acid;5-Methoxy-1H-indole-3-acetic acid;5-Methoxy-3-indoleacetic acid;5-Methoxy-3-indolylacetic acid;5-Methoxy-IAA;5-Methoxyindoleacetic acid;Methoxyindoleacetic acid; |
| CAS: | 3471-31-6 |
| EINECS: | 222-438-3 |
| Molecular Formula: | C11H11NO3 |
| Molecular Weight: | 205.21 |
| InChI: | InChI=1/C11H11NO3/c1-15-8-2-3-10-9(5-8)7(6-12-10)4-11(13)14/h2-3,5-6,12H,4H2,1H3,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | off-white to light brown crystalline powder |
| Storage Temperature: | 2-8°C |
| Color: | light yellow to tan |
| Safety Data |
| |
 |
