Identification |
Name: | Formamidine acetate |
Synonyms: | Methanimidamide monoacetate; |
CAS: | 3473-63-0 |
EINECS: | 222-442-5 |
Molecular Formula: | C2H4O2.CH4N2 |
Molecular Weight: | 104.11 |
InChI: | InChI=1/C2H4O2.CH4N2/c1-2(3)4;2-1-3/h1H3,(H,3,4);1H,(H3,2,3) |
Molecular Structure: |
 |
Properties |
Density: | 1.124 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | 832 g/L (21 ºC) in water |
Appearance: | white to light yellow crystalline powder |
HS Code: | 29252000 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Hygroscopic |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |