| Identification | |
| Name: | 4-Piperidinone,3-methyl-1-(phenylmethyl)- |
| Synonyms: | 4-Piperidone,1-benzyl-3-methyl- (6CI,7CI); 1-Benzyl-3-methyl-4-oxopiperidine;1-Benzyl-3-methyl-4-piperidone; 1-Benzyl-3-methylpiperidin-4-one;3-Methyl-1-(phenylmethyl)-4-piperidinone; N-Benzyl-3-methyl-4-piperidinone;N-Benzyl-3-methyl-4-piperidone |
| CAS: | 34737-89-8 |
| EINECS: | 252-176-5 |
| Molecular Formula: | C13H17 N O |
| Molecular Weight: | 203.28 |
| InChI: | InChI=1/C13H17NO/c1-11-9-14(8-7-13(11)15)10-12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.9°C |
| Boiling Point: | 314.9°Cat760mmHg |
| Density: | 1.057g/cm3 |
| Refractive index: | 1.5315-1.5335 |
| Specification: |
1-Benzyl-3-methyl-4-piperidone , with CAS number of 34737-89-8, can be called Timtec-bb sbb001741 ; 4-piperidinone, 3-methyl-1-(phenylmethyl)- ; 1-benzyl-3-methyl-4-piperidone ; 1-benzyl-3-methylpiperidin-4-one ; N-BeNzyl-3-methyl-4-piperidoNe ; 3-Methyl-1-(phenylmethyl)-4-piperidinone ; 1-Benzyl-3-methyl-4-piperidone,99% . It is a clear slightly yellow to yellow liquid. |
| Flash Point: | 134.9°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
