| Identification | |
| Name: | 2-Furanpropanal,5-methyl- |
| Synonyms: | 2-Furanpropionaldehyde,5-methyl- (7CI);3-(5-Methyl-2-furyl)propanal;3-(5-Methyl-2-furyl)propionaldehyde;3-(5-Methylfuryl)propanal;5-Methyl-2-furanpropanal;NSC 239322; |
| CAS: | 34756-16-6 |
| EINECS: | 252-190-1 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-7-4-5-8(10-7)3-2-6-9/h4-6H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 75.1°C |
| Boiling Point: | 187.8°Cat760mmHg |
| Density: | 1.022g/cm3 |
| Refractive index: | 1.47 |
| Specification: |
The 5-Methylfuran-2-propionaldehyde with the CAS number 34756-16-6 is also called 2-Furanpropanal,5-methyl-. Both the systematic name and IUPAC name are 3-(5-methylfuran-2-yl)propanal. Its EINECS registry number is 252-190-1. The molecular formula is C8H10O2. The properties of the chemical are: (1)ACD/LogP: 1.66; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.66; (4)ACD/LogD (pH 7.4): 1.66; (5)ACD/BCF (pH 5.5): 10.7; (6)ACD/BCF (pH 7.4): 10.7; (7)ACD/KOC (pH 5.5): 189.9; (8)ACD/KOC (pH 7.4): 189.9; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 30.21 Å2; (13)Index of Refraction: 1.47; (14)Molar Refractivity: 37.74 cm3; (15)Molar Volume: 135.1 cm3; (16)Polarizability: 14.96×10-24cm3; (17)Surface Tension: 33 dyne/cm; (18)Enthalpy of Vaporization: 42.4 kJ/mol; (19)Vapour Pressure: 0.62 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 75.1°C |
| Safety Data | |
 |
|
