| Identification | |
| Name: | Boron,trichloro(N,N-dimethyl-1-octanamine)-,(T-4)- |
| Synonyms: | 1-Octanamine,N,N-dimethyl-,compd.with trichloroborane (1:1);1-Octanamine,N,N-dimethyl-,boron complex;Borane,trichloro-,compd with N,N-dimethyl-1-octanamine(1:1);Araldite DY 9577;Boron trichloride compd with octyldimethylamine(1:1);Borontrichloride-N,N-dimethyloctylamine adduct (1:1);Borontrichloride-N,N-dimethyloctylamine complex(1:1);Borontrichloride-dimethyloctylamine compd(1:1);Borontrichloride-octyldimethylamine compd(1:1);Borontrichloride-octyldimethylamine complex(1:1);DY 9577 |
| CAS: | 34762-90-8 |
| EINECS: | 252-200-4 |
| Molecular Formula: | C10H23 B Cl3 N |
| Molecular Weight: | 274.46632 |
| InChI: | InChI=1/C10H23N.B.3ClH/c1-4-5-6-7-8-9-10-11(2)3;;;;/h4-10H2,1-3H3;;3*1H/q;+3;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65°C |
| Boiling Point: | 191.6°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 65°C |
| Safety Data | |
 |
|
