| Identification | |
| Name: | Benzoic acid,3,4-dichloro-, 3-(2-methyl-1-piperidinyl)propyl ester |
| Synonyms: | Benzoicacid, 3,4-dichloro-, 3-(2-methylpiperidino)propyl ester (7CI,8CI);1-Piperidinepropanol, 2-methyl-, 3,4-dichlorobenzoate (ester) (8CI);3-(2-Methylpiperidino)propyl 3,4-dichlorobenzoate; EL 211; Piperalin; Pipron; g-(2-Methylpiperidino)propyl3,4-dichlorobenzoate |
| CAS: | 3478-94-2 |
| EINECS: | 222-455-6 |
| Molecular Formula: | C16H21 Cl2 N O2 |
| Molecular Weight: | 330.28 |
| InChI: | InChI=1/C16H21Cl2NO2/c1-12-5-2-3-8-19(12)9-4-10-21-16(20)13-6-7-14(17)15(18)11-13/h6-7,11-12H,2-5,8-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Melting Point: | Decomposes at 208 deg C |
| Flash Point: | 213°C |
| Boiling Point: | 428.5°Cat760mmHg |
| Density: | 1.188g/cm3 |
| Refractive index: | 1.534 |
| Solubility: | Solubility: 3-5 g/100 ml in acetonitrile, 5-10 g/100 ml in hexane, and 5-10 g/100 ml in methanol Miscible in acetone, chloroform, dichloromethane, ethyl acetate, and toluene. Miscible with paraffin hydrocarbon, aromatic hydrocarbon, and chlorinated hydrocarbon solvents. In water, 20 mg/l, temp not specified |
| Flash Point: | 213°C |
| Color: | Viscous amber liquid |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
 |
|
