Identification |
Name: | 1-Chloro-2-fluorobenzene |
Synonyms: | ChlorofluorobenzeneChlorofluorobenzene; 2-Chlorofluorobenzene |
CAS: | 348-51-6 |
EINECS: | 206-476-8 |
Molecular Formula: | C6H4ClF |
Molecular Weight: | 130.55 |
InChI: | InChI=1/C6H4ClF/c7-5-3-1-2-4-6(5)8/h1-4H |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 1.244 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5-1.502 |
Solubility: | Insoluble |
Appearance: | colorless to light brown clear liquid |
Packinggroup: | III |
Storage Temperature: | Flammables area |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |