| Identification | |
| Name: | 1-(2-Pyridyl)piperazine |
| Synonyms: | Pyridylpiperazine,98%; Pyridylpiperazine,97%; 2-(1-Piperazino)pyridine; 1-(2-Pyridinyl)piperazine |
| CAS: | 34803-66-2 |
| EINECS: | 252-220-3 |
| Molecular Formula: | C9H13N3 |
| Molecular Weight: | 163.22 |
| InChI: | InChI=1/C9H13N3/c1-2-4-11-9(3-1)12-7-5-10-6-8-12/h1-4,10H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Density: | 1.072 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.593-1.595 |
| Water Solubility: | >500 g/L (20 oC) |
| Appearance: | clear, colorless to pale yellow liquid. |
| Specification: |
1-(2-Pyridinyl)piperazine , its CAS NO. is 34803-66-2, the synonyms are 2-Piperazinopyridine ; 1-Pyridin-2-yl-piperazine ; Piperazine, 1-(2-pyridinyl)- . |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
