| Identification | |
| Name: | 9-Anthracenecarboxamide |
| Synonyms: | 9-Anthramide(6CI,7CI) |
| CAS: | 34810-13-4 |
| Molecular Formula: | C15H11 N O |
| Molecular Weight: | 221.25 |
| InChI: | InChI=1/C15H11NO/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H2,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 275.6°C |
| Boiling Point: | 424.6°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.631 |
| Specification: |
9-Anthraldehyde oxime (34810-13-4) is nitrogen compounds which also can be called for 9-Anthracenecarboxamide and 9-Anthramide . |
| Flash Point: | 275.6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
