| Identification | |
| Name: | 5-AMINO-4-IMIDAZOLECARBOXAMIDE UREIDOSUCCINATE |
| Synonyms: | CARBAICA;5-amino-4-imidazolecarboxamideureidosuccinate;mide(1:1);n-(aminocarbonyl)-l-asparticacicompd.with5-amino-1h-imidazole-4-carboxa;5(4)-amino-4(5)-imidazolecarboxamide ureidosuccinate |
| CAS: | 34879-34-0 |
| Molecular Formula: | C5H8N2O5 . CaH6N4O |
| Molecular Weight: | 302.29 |
| InChI: | InChI=1/C5H8N2O5.C4H6N4O/c6-5(12)7-2(4(10)11)1-3(8)9;5-3-2(4(6)9)7-1-8-3/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12);1H,5H2,(H2,6,9)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 175.4°C |
| Boiling Point: | 366.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
5-Amino-4-imidazolecarboxamide ureidosuccinate ,with CAS number of 34879-34-0,can be called Carbaica . 5-Amino-4-imidazolecarboxamide ureidosuccinate (CAS NO.34879-34-0) is a moderately toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Report: |
5-Amino-4-imidazolecarboxamide ureidosuccinate (CAS NO.34879-34-0) was reported in DECRDP Drugs under Experimental and Clinical Research. |
| Flash Point: | 175.4°C |
| Safety Data | |
 |
|
