| Identification | |
| Name: | 1,1'-Biphenyl,2,4'-dichloro- |
| Synonyms: | Biphenyl,2,4'-dichloro- (7CI); 2,4'-Dichlorobiphenyl; CB 8; PCB 8 |
| CAS: | 34883-43-7 |
| EINECS: | 215-648-1 |
| Molecular Formula: | C12H8 Cl2 |
| Molecular Weight: | 223.10 |
| InChI: | InChI=1S/C12H8Cl2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3432 9/PG 2 |
| Flash Point: | 133.6°C |
| Boiling Point: | 303.3°Cat760mmHg |
| Density: | 1.249g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
2,4'-Dichloro-1,1'-biphenyl ,its cas register number is 34883-43-7. It also can be called 2,4'-Dichlorobiphenyl ; and 1,1'-Biphenyl, 2,4'-dichloro- . |
| Flash Point: | 133.6°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
