| Identification | |
| Name: | 2-Propenoic acid,2-cyano-3,3-bis(methylthio)-, methyl ester |
| Synonyms: | Acrylicacid, 2-cyano-3-oxo-, methyl ester, 3-(dimethyl mercaptole) (8CI);Acrylicacid, 2-cyano-3-oxo-, methyl ester, dimethyl mercaptole (7CI);1-Cyano-1-(methoxycarbonyl)-2,2-bis(methylthio)ethylene;2-Cyano-3,3-bis(methylsulfanyl)prop-2-enoic acid methyl ester;2-Cyano-3,3-di(methylthio)acrylic acid methyl ester;3,3-(Bismethylthio)-2-cyanoacrylic acid methyl ester;Methyl2-cyano-3,3-bis(methylthio)-2-propenoate;Methyl2-cyano-3,3-bis(methylthio)acrylate;Methyl3,3-bis(methylthio)-2-cyanoacrylate;Methylbis(methylthio)methylenecyanoacetate;NSC 266105; |
| CAS: | 3490-92-4 |
| Molecular Formula: | C7H9NO2S2 |
| Molecular Weight: | 203.28 |
| InChI: | InChI=1/C7H9NO2S2/c1-10-6(9)5(4-8)7(11-2)12-3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.7°C |
| Boiling Point: | 300.8°Cat760mmHg |
| Density: | 1.254g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
Methyl2-cyano-3,3-bis(methylthio)acrylate , its cas register number is 3490-92-4. It also can be called Acrylicacid, 2-cyano-3-oxo-, methyl ester, 3-(dimethyl mercaptole) (8CI) ; 2-Cyano-3,3-bis(methylsulfanyl)prop-2-enoic acid methyl ester ; and Methyl2-cyano-3,3-bis(methylthio)-2-propenoate . |
| Flash Point: | 135.7°C |
| Safety Data | |
 |
|
