| Identification | |
| Name: | Aluminum,trichloro[(nitro-kO)methane]-,(T-4)- |
| Synonyms: | Aluminum,trichloro(nitromethane)- (6CI,7CI); Aluminum, trichloro(nitromethane-O)-,(T-4)-; Aluminum chloride 1:1 complex with nitromethane; Aluminum chloride,compd. with nitromethane (1:1) |
| CAS: | 3495-54-3 |
| Molecular Formula: | CH3 Al Cl3 N O2 |
| Molecular Weight: | 194.38 |
| InChI: | InChI=1S/CH3NO2.Al.3ClH/c1-2(3)4;;;;/h1H3;;3*1H/q;+3;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Methane, nitro-, compd. with aluminum chloride (1:1) (CAS NO.3495-54-3 ) can be called Nitromethane compd. with aluminum chloride (1:1) . |
| Safety Data | |
 |
|
