| Identification | |
| Name: | 3-Fluoro-4-methylbenzoic acid |
| Synonyms: | p-Toluicacid, 3-fluoro- (8CI);3-Fluoro-4-toluic acid;NSC 56683; |
| CAS: | 350-28-7 |
| EINECS: | 206-498-8 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.258 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
3-Fluoro-4-methylbenzoic acid , its cas register number is 350-28-7. It also can be called p-Toluicacid, 3-fluoro- (8CI) ; 3-Fluoro-4-toluic acid .It is a white to light yellow crystal powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
