| Identification |
| Name: | Benzene,1-fluoro-4-(1-methylethenyl)benzene |
| Synonyms: | Styrene,p-fluoro-a-methyl- (6CI,7CI,8CI);1-Fluoro-4-isopropenylbenzene;2-(4-Fluorophenyl)-1-propene;2-(4-Fluorophenyl)propene;4-Fluoro-1-isopropenylbenzene;4-Fluoro-a-methylstyrene;NSC 74474;p-Fluoro-a-methylstyrene; |
| CAS: | 350-40-3 |
| EINECS: | 206-501-2 |
| Molecular Formula: | C9H9F |
| Molecular Weight: | 136.17 |
| InChI: | InChI=1/C9H9F/c1-7(2)8-3-5-9(10)6-4-8/h3-6H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.009 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5085-1.5125 |
| Appearance: | clear slightly yellow clear liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | colorless to yellow/brown |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
