| Identification | |
| Name: | 1-Fluoro-4-nitrobenzene |
| Synonyms: | Fluoronitrobenzene3; Fluoronitrobenzenecolorlesssolid; 4-Fluoronitrobenzene; p-fluoronitrobenzene |
| CAS: | 350-46-9 |
| EINECS: | 206-502-8 |
| Molecular Formula: | C6H4FNO2 |
| Molecular Weight: | 141.1 |
| InChI: | InChI=1/C6H4FNO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Density: | 1.33 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5302-1.5322 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear to yellow liquid |
| Specification: |
?4-Fluoronitrobenzene (CAS NO.350-46-9), its Synonyms are 1-Fluoro-4-nitrobenzene ; 1-Nitro-4-fluorobenzene ; 4-Fluoro-1-nitrobenzene ; 4-Nitrofluorobenzene ; Benzene, 1-fluoro-4-nitro- ; p-Fluoronitrobenzene ; p-Nitrofluorobenzene . It is yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29049085 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | deep greenish-yellow |
| Usage: | A component of hair dyes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
