Identification |
Name: | 2,3-Butanediol,(2R,3R)-rel- |
CAS: | 35007-63-7 |
Molecular Formula: | C4H10 O2 |
Molecular Weight: | 72.1057 |
InChI: | InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 19 deg C |
Flash Point: | °C |
Boiling Point: | 77.6°Cat760mmHg |
Density: | 0.784g/cm3 |
Solubility: | Easily soluble in low molecular mass alcohols and ketones. Soluble in alcohol and ether. Moderately sol in diisopropyl ether. In water, miscible at 20 deg C |
Flash Point: | °C |
Color: | Nearly colorless, crystalline solid or liquid. |
Safety Data |
|
 |