| Identification | |
| Name: | 1,1'-Biphenyl,2,2',4,4',5,5'-hexachloro- |
| Synonyms: | Biphenyl,2,2',4,4',5,5'-hexachloro- (6CI); 2,2',4,4',5,5'-Hexachloro-1,1'-biphenyl;2,2',4,4',5,5'-Hexachlorobiphenyl; 2,4,5,2',4',5'-Hexachlorobiphenyl; CB 153; K153; PCB 153 |
| CAS: | 35065-27-1 |
| Molecular Formula: | C12H4 Cl6 |
| Molecular Weight: | 360.8782 |
| InChI: | InChI=1S/C12H4Cl6/c13-7-3-11(17)9(15)1-5(7)6-2-10(16)12(18)4-8(6)14/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2315 |
| Melting Point: | 103-104ºC |
| Density: | 1.593 g/cm3 |
| Stability: | Thermally stable and resistant to both oxidation and biological degradation. |
| Refractive index: | 1.626 |
| Appearance: | colourless liquid |
| Specification: |
2,2',4,4',5,5'-Hexachlorobiphenyl with CAS Registry Number of 35065-27-1 is also known as 2,4,5,2',4',5'-Hexachlorobiphenyl ; 1,1'-Biphenyl, 2,2',4,4',5,5'-hexachloro- ; 2,2',4,4',5,5'-Hexachloro-1,1'biphenyl ; 2,2',4,4',5,5'-Hexachlorobiphenyl ; 2,2',4,4'5,5'-Hexachlorobiphenyl ; 2,4,5,2',4',5'-Hexachlorobiphenyl ; Biphenyl, 2,2',4,4',5,5'-hexachloro- ; CB-153 ; CCRIS 9204 ; HCBP ; HSDB 3946 ; K 153 ; PCB 153 ; 2,2',4,4',5,5'-Hexachloro-1,1'-biphenyl (9CI) . It is used as a standard in analytical test. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
N: Dangerous for the environment
Xn: Harmful
|
 |
|
