| Identification | |
| Name: | 3,5-Diacetoxy Acetophenone |
| Synonyms: | 3,5-Diacetoxyacetophonone; 1-[3,5-Bis(acetyloxy)phenyl]-ethanone; 3',5'-DIACETOXYACETOPHENONE; 3,5-DIACETOXYACETOPHENONE; 3',5'-DIACETYLOXYACETPHENONE; 3-ACETYL-5-(ACETYLOXY)PHENYL ACETATE; 5-ACETYL-1,3-PHENYLENE DIACETATE; 3',5'-Diacetoxyacetophenone 3-Acetyl-5-(Acetyloxy)phenyl Acetate |
| CAS: | 35086-59-0 |
| EINECS: | 252-354-2 |
| Molecular Formula: | C12H12O5 |
| Molecular Weight: | 236.22 |
| InChI: | InChI=1/C12H12O5/c1-7(13)10-4-11(16-8(2)14)6-12(5-10)17-9(3)15/h4-6H,1-3H3 |
| Molecular Structure: | ![(C12H12O5) 3,5-Diacetoxyacetophonone; 1-[3,5-Bis(acetyloxy)phenyl]-ethanone; 3',5'-DIACETOXYACETOPHENONE; 3,5-D...](https://img.guidechem.com/casimg/35086-59-0.gif) |
| Properties | |
| Density: | 1.203 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.512 |
| Appearance: | yellow to brown powder |
| Specification: |
?5-Acetyl-1,3-phenylene diacetate , its cas register number is 35086-59-0. It also can be called?3,5-Diacetoxyacetophenone ; 1-[3,5-Bis(acetyloxy)phenyl]-ethanone .It is a?yellow to brown powder. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
