| Identification | |
| Name: | Guanidine,N-hexyl-N'-nitro-N-nitroso- (9CI) |
| Synonyms: | 1-Hexyl-3-nitro-1-nitrosoguanidine;N-Hexyl-N-nitroso-N'-nitroguanidine; N-Hexyl-N'-nitro-N-nitrosoguanidine |
| CAS: | 35089-70-4 |
| Molecular Formula: | C7H15 N5 O3 |
| Molecular Weight: | 217.27 |
| InChI: | InChI=1/C7H15N5O3/c1-2-3-4-5-6-11(10-13)7(8)9-12(14)15/h2-6H2,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.6°C |
| Boiling Point: | 335.4°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
1-Hexyl-3-nitro-1-nitrosoguanidine with cas registry number of 35089-70-4 is also known as Guanidine,1-hexyl-3-nitro-1-nitroso- ; N-Hexyl-N'-nitro-N-nitrosoguanidine ; Guanidine,N-hexyl-N'-nitro-N-nitroso- . It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. 1-Hexyl-3-nitro-1-nitrosoguanidine with cas registry number of 35089-70-4 is used as a pharmaceutical intermediate . It is also used as a reagent in biochemistry research . |
| Flash Point: | 156.6°C |
| Safety Data | |
 |
|
