| Identification | |
| Name: | 2-Fluoropyridine-5-boronic acid |
| Synonyms: | 6-Fluoropyridine-3-boronic acid; |
| CAS: | 351019-18-6 |
| Molecular Formula: | C5H5BFNO2 |
| Molecular Weight: | 140.91 |
| InChI: | InChI=1/C5H5BFNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3,9-10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.34 g/cm3 |
| Refractive index: | 1.507 |
| Appearance: | white to light yellow solid |
| Specification: |
?2-Fluoropyridine-5-boronic acid , its cas register number is 351019-18-6. It also can be called 6-Fluoropyridine-3-boronic acid . It is a white to light yellow solid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
