| Identification | |
| Name: | Adenosine, 2-iodo- |
| Synonyms: | 2-Iodoadenosine; |
| CAS: | 35109-88-7 |
| Molecular Formula: | C10H12IN5O4 |
| Molecular Weight: | 393.1379 |
| InChI: | InChI=1/C10H12IN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.69 g/cm3 |
| Refractive index: | 1.994 |
| Appearance: | Off-white crystalline solid |
| Usage: | An intermediate in the synthesis of isoguanosine (crotonoside or 2-hydroxyadenosine), a naturally occuring nucleoside analogue of guanosine. Isoguanosine is incorporated into mammalian but not bacterial nucleic acids, stimulates the accumulation of |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
