| Identification |
| Name: | 1,3-Propanediol,2-methylene- |
| Synonyms: | 2-Methylene-1,3-propanediol |
| CAS: | 3513-81-3 |
| EINECS: | 222-516-7 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-4(2-5)3-6/h5-6H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.08 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.473-1.475 |
| Solubility: | Very soluble |
| Appearance: | clear colorless to pale yellow viscous liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
