| Identification | |
| Name: | 9-Dodecen-1-ol,1-acetate, (9E)- |
| Synonyms: | 9-Dodecen-1-ol,acetate, (9E)- (9CI); 9-Dodecen-1-ol, acetate, (E)-; (9E)-Dodecen-1-yl acetate;(E)-1-Acetoxy-9-dodecene; (E)-9-Dodecen-1-ol acetate; (E)-9-Dodecenyl acetate;E-9-Dodecen-1-yl acetate; trans-9-Dodecen-1-yl acetate; trans-9-Dodecenylacetate |
| CAS: | 35148-19-7 |
| EINECS: | 252-397-7 |
| Molecular Formula: | C14H26 O2 |
| Molecular Weight: | 226.36 |
| InChI: | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-5H,3,6-13H2,1-2H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 96.5°C |
| Boiling Point: | 300.1°Cat760mmHg |
| Density: | 0.881g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
(E)-9-Dodecenyl acetate with cas registry number of 35148-19-7 is also called for (E)-9-Dodecen-1-ol acetate ; (E)-9-Dodecen-1-yl acetate ; (E)-Dodec-9-enyl acetate ; 9-Dodecen-1-ol, 1-acetate, (9E)- ; 9-Dodecen-1-ol, acetate, (9E)- ; 9-Dodecen-1-ol, acetate, (E)- ; AI3-33973 ; EPA Pesticide Chemical Code 119004 . |
| Flash Point: | 96.5°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
