Identification |
Name: | benzene-1,3-dicarboxylic acid; hexanedioic acid; 2-(2-hydroxyethoxy)ethanol |
Synonyms: | 1,3-Benzenedicarboxylic acid, polymer with hexanedioic acid and 2,2-oxybisethanol;benzene-1,3-dicarboxylic acid: hexanedioic acid: 2-(2-hydroxyethoxy)et hanol;Diethylene glycol, adipic acid, isophthalic acid polyester;Diethylene glycol, adipic acid, isophthalic acid polymer;Adipic acid-diethyleneglycol-isophthalic acid copolymer |
CAS: | 35164-40-0 |
Molecular Formula: | C18H26O11 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C8H6O4.C6H10O4.C4H10O3/c9-7(10)5-2-1-3-6(4-5)8(11)12;7-5(8)3-1-2-4-6(9)10;5-1-3-7-4-2-6/h1-4H,(H,9,10)(H,11,12);1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 217.3°C |
Boiling Point: | 412.3°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 217.3°C |
Safety Data |
|
|