| Identification |
| Name: | 4-Fluoroiodobenzene |
| Synonyms: | 4-Fluoro-iodobenzene; 1-Fluoro-4-iodobenzene |
| CAS: | 352-34-1 |
| EINECS: | 206-522-7 |
| Molecular Formula: | C6H4FI |
| Molecular Weight: | 222 |
| InChI: | InChI=1/C6H4FI/c7-5-1-3-6(8)4-2-5/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2810 |
| Density: | 1.925 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.582-1.584 |
| Appearance: | colorless to light yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
