| Identification |
| Name: | Cyclohexanone,2-amino-2-(2-chlorophenyl)- |
| Synonyms: | 2-(o-Chlorophenyl)-2-aminocyclohexanone;2-Amino-2-(o-chlorophenyl)cyclohexanone;N-Demethylketamine;Norketamine; |
| CAS: | 35211-10-0 |
| Molecular Formula: | C12H14ClNO |
| Molecular Weight: | 260.16 |
| InChI: | InChI=1/C12H14ClNO/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15/h1-2,5-6H,3-4,7-8,14H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 176.7°C |
| Boiling Point: | 368.6°Cat760mmHg |
| Density: | 1.208g/cm3 |
| Refractive index: | 1.568 |
| Biological Activity: | Major metabolite of ketamine that is a potent non-competitive NMDA receptor antagonist (K i = 3.6 μ M for displacement of [ 3 H]-MK 801 in rat brain). Antinociceptive and anesthetic in vivo . |
| Flash Point: | 176.7°C |
| Safety Data |
| |
 |
