| Identification | |
| Name: | 1H-Indazole, 6-methoxy- |
| Synonyms: | 6-Methoxyindazole; |
| CAS: | 3522-07-4 |
| Molecular Formula: | C8H8N2O |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C8H8N2O/c1-11-7-3-2-6-5-9-10-8(6)4-7/h2-5H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.244 g/cm3 |
| Refractive index: | 1.647 |
| Specification: |
The 6-Methoxyindazole , its cas register number is 3522-07-4.It also can be called as 6-Methoxy-1H-indazole and its IUPAC name is 6-methoxy-1H-indazole .It belongs to the following product categories, such as Intermediate, organic materials, heterocyclic compounds and pharmaceutical intermediates. Following are the physical and chemical properties about 6-Methoxyindazole : (1)#H bond acceptors: 3 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 37.91 Å ; (5)Index of Refraction: 1.647 ; (6)Molar Refractivity: 43.298 cm3 ; (7)Molar Volume: 119.098 cm3; (8)Surface Tension: 53.121 dyne/cm ; (9)Enthalpy of Vaporization: 53.143 kJ/mol ; (10)Vapour Pressure: 0.001 mmHg at 25°C 6-Hydroxyindazole was methylated to give 6-methoxyindazole and 6-hydroxy-2-methylindazole. This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
