| Identification | |
| Name: | 4-bromomethyl-7-methoxycoumarin |
| Synonyms: | 4-(Bromomethyl)-7-methoxy-2H-chromen-2-one;4-(Bromomethyl)-7-methoxy-2H-chromene-2-one; 4-Bromomethyl-7-methoxy-2-oxo-2H-benzopyran;4-Bromomethyl-7-methoxycoumarin; 7-Methoxy-4-(bromomethyl)coumarin |
| CAS: | 35231-44-8 |
| EINECS: | 252-448-3 |
| Molecular Formula: | C11H9BrO3 |
| Molecular Weight: | 269.09 |
| InChI: | InChI=1/C11H9BrO3/c1-14-8-2-3-9-7(6-12)4-11(13)15-10(9)5-8/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Density: | 1.552 g/cm3 |
| Stability: | Stable, but moisture and light-sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.594 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Light Green-Yellow Crystals |
| Specification: |
4-Bromomethyl-7-methoxycoumarin (CAS NO.35231-44-8), its Synonyms are 4-Bromomethyl-7-methoxy-2-oxo-2H-benzopyran ; 2H-1-Benzopyran-2-one, 4-(bromomethyl)-7-methoxy- ; 4-(Brommethyl)-7-methoxy-2H-chromen-2-on ; 4-(Bromomethyl)-7-methoxy-2H-chromen-2-one ; 4-(Bromométhyl)-7-méthoxy-2H-chromén-2-one . It is light green-yellow crystals. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Usage: | Used for derivatization, TLC and HPLC separation, and fluorometric analysis of a wide range of naturally occurring acids, including bile and thromboxane B2 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
