| Identification |
| Name: | 2-Propenoic-3,3-d2acid, 2-(methyl-d3)-, methyl-d3 ester |
| Synonyms: | Methylmethacrylate-d8;Perdeuterated methyl methacrylate; |
| CAS: | 35233-69-3 |
| EINECS: | 252-449-9 |
| Molecular Formula: | C5D8O2 |
| Molecular Weight: | 100.1158 |
| InChI: | InChI=1/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3/i1D2,2D3,3D3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1247 3 |
| Stability: | Stable, but may polymerize upon exposure to light. Highly flammable - store cold. Hygroscopic. Incompatible with oxidizing agents, bases, amines, peroxides, acids, reducing agents, halogens, polymerization initiators. |
| Refractive index: | n20/D 1.413(lit.) |
| Solubility: | |
| Appearance: | clear, colorless liquid |
| Storage Temperature: | 0-6°C |
| Safety Data |
| |
 |
