Identification |
Name: | Urea,N-methyl-N-(methyl-d3)-N'-[4-(1-methylethyl)phenyl]- (9CI) |
Synonyms: | ISOPROTURON-D3;ISOPROTURON-D3 (N-METHYL-D3);Arelon-d3;HOE-16410-d3;I.P.U.-d3;N,N,-Dimethyl-d3-N[4-(1-methylethyl)phenyl]urea;Protugan-d3 |
CAS: | 352438-80-3 |
Molecular Formula: | C12H15 D3 N2 O |
Molecular Weight: | 209.3 |
InChI: | InChI=1/C12H18N2O/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4/h5-9H,1-4H3,(H,13,15)/i3D3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 1580C |
Flash Point: | 167.406°C |
Boiling Point: | 353.194°C at 760 mmHg |
Density: | 1.066g/cm3 |
Refractive index: | 1.555 |
Flash Point: | 167.406°C |
Usage: | Pre-and post-emergence herbicide for control of annual grasses and broad-leaved weeds |
Safety Data |
|
 |