| Identification | |
| Name: | 5,6-Dihydro-7,12-dimethyl-benz(a)anthracene |
| Synonyms: | 5,6-Dihydro-7,12-dimethylbenz[a]anthracene |
| CAS: | 35281-29-9 |
| Molecular Formula: | C20H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H18/c1-13-16-8-5-6-9-17(16)14(2)20-18(13)12-11-15-7-3-4-10-19(15)20/h3-10H,11-12H2,1-2H3 |
| Molecular Structure: | ![(C20H18) 5,6-Dihydro-7,12-dimethylbenz[a]anthracene](https://img.guidechem.com/crawlimg/35281-29-9.png) |
| Properties | |
| Flash Point: | 210.6°C |
| Boiling Point: | 435°C at 760 mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.659 |
| Specification: |
5,6-Dihydro-7,12-dimethyl-benz(a)anthracene , its cas register number is 35281-29-9. It also can be called BRN 2111994 ; NSC 113558 ; Benz(a)anthracene, 5,6-dihydro-7,12-dimethyl- . When 5,6-Dihydro-7,12-dimethyl-benz(a)anthracene (CAS NO.35281-29-9) is heated to decomposition, it emits acrid smoke and irritating fumes. |
| Flash Point: | 210.6°C |
| Safety Data | |
 |
|
