| Identification | |
| Name: | 3,4-Dimethoxybenzoyl chloride |
| Synonyms: | Veratroylchloride (7CI,8CI);3,4-Dimethoxy-1-benzenecarbonyl chloride;3,4-Dimethoxybenzoic acid chloride;Benzoylchloride, 3,4-dimethoxy-;3,4-Dimethoxyphenylcarbonyl chloride;Veratric acid chloride; |
| CAS: | 3535-37-3 |
| EINECS: | 222-568-0 |
| Molecular Formula: | C9H9ClO3 |
| Molecular Weight: | 200.6213 |
| InChI: | InChI=1/C9H9ClO3/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Density: | 1.224 g/cm3 |
| Refractive index: | 1.52 |
| Appearance: | off-white to grey crystals, flakes or chunks |
| Specification: |
3,4-Dimethoxybenzoyl chloride (CAS NO.3535-37-3) is also named as 3,4-dimethoxybenzene-1-carbonyl chloride ; Benzoyl chloride, 3,4-dimethoxy- ; Veratroyl chloride . 3,4-Dimethoxybenzoyl chloride (CAS NO.3535-37-3) is off-white to grey crystals, flakes or chunks. |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
