| Identification | |
| Name: | Benzene,(chloromethoxymethyl)- |
| Synonyms: | Ether, a-chlorobenzyl methyl (6CI);(Chloromethoxymethyl)benzene;a-Chloro-a-methoxytoluene;a-Chlorobenzyl methyl ether;a-Methoxybenzyl chloride; |
| CAS: | 35364-99-9 |
| EINECS: | 252-527-2 |
| Molecular Formula: | C8H9ClO |
| Molecular Weight: | 156.6095 |
| InChI: | InChI=1/C8H9ClO/c1-10-8(9)7-5-3-2-4-6-7/h2-6,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.118 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
The IUPAC name of (Chloromethoxymethyl)benzene is Chloromethoxymethylbenzene. With the CAS registry number 35364-99-9, it is also named as Benzene,(chloromethoxymethyl)-. In addition, its molecular formula is C8H9ClO and its molecular weight is 156.61. The other characteristics of (Chloromethoxymethyl)benzene can be summarized as: (1)EINECS: 252-527-2; (2)ACD/LogP: 2.32; (3)# of Rule of 5 Violations: 0; (4)ACD/LogD (pH 5.5): 2.32; (5)ACD/LogD (pH 7.4): 2.32; (6)ACD/BCF (pH 5.5): 33.85; (7)ACD/BCF (pH 7.4): 33.85; (8)ACD/KOC (pH 5.5): 432.99; (9)ACD/KOC (pH 7.4): 432.99; (10)H bond acceptors: 1; (11)H bond donors: 0; (12)Freely Rotating Bonds: 3; (13)Polar Surface Area: 9.23 Å2; (14)Index of Refraction: 1.517; (15)Molar Refractivity: 42.39 cm3; (16)Molar Volume: 139.9 cm3; (17)Polarizability: 16.8×10-24cm3; (18)Surface Tension: 35.6 dyne/cm; (19)Density: 1.118 g/cm3; (20)Flash Point: 91.1 °C; (21)Enthalpy of Vaporization: 42.52 kJ/mol; (22)Boiling Point: 207.1 °C at 760 mmHg; (23)Vapour Pressure: 0.33 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
