| Identification |
| Name: | 1H-Imidazole-1-aceticacid, 2-amino-4,5-dihydro- |
| Synonyms: | 1-Carboxymethyl-2-iminoimidazolidine;Cyclocreatine; |
| CAS: | 35404-50-3 |
| Molecular Formula: | C5H9N3O2 |
| Molecular Weight: | 143.14 |
| InChI: | InChI=1/C5H9N3O2/c6-5-7-1-2-8(5)3-4(9)10/h1-3H2,(H2,6,7)(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 165.5°C |
| Boiling Point: | 350°Cat760mmHg |
| Density: | 1.56g/cm3 |
| Refractive index: | 1.659 |
| Flash Point: | 165.5°C |
| Usage: | Can regulate creatine biosynthesis by suppressing the level of arginine:glycine amidinotransferase in chick liver |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
