| Identification | |
| Name: | Benzamide, 3-amino- |
| Synonyms: | Benzamide,m-amino- (6CI,8CI);3-(Aminocarbonyl)aniline;3-Aminobenzamide;3-Carboxamidoaniline;NSC 36962;SR 4294;WD 97-000835;[3-(Aminocarbonyl)phenyl]amine;m-Aminobenzamide; |
| CAS: | 3544-24-9 |
| EINECS: | 222-586-9 |
| Molecular Formula: | C7H8N2O |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C7H8N2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.233 g/cm3 |
| Refractive index: | 1.632 |
| Water Solubility: | ethanol: 50 mg/mL, clear, faintly yellow |
| Solubility: | ethanol: 50 mg/mL, clear, faintly yellow |
| Appearance: | white to off-white powder |
| Specification: |
3-Aminobenzamide with CAS number of 3544-24-9 is also named as M-aminobenzamide ; 3-Aba ; 3-Aminobenzamide ; 3-Amino-benzamid ; Benzamide, 3-amino- ; Benzamide, m-amino- ; m-amino-benzamid ; 3-AB . As in any fire,Use water spray, dry chemical, carbon dioxide, or chemical foam . It shoud avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. Store in a cool, dry place. Store in a tightly closed container. This product can be used as organic reagents and pharmaceutical intermediate. |
| Storage Temperature: | Store under inert gas |
| Sensitive: | Light Sensitive |
| Color: | white to off-white |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
