| Identification | |
| Name: | Iproclozide |
| Synonyms: | 1-(p-Chlorophenoxyacetyl)-2-isopropyl hydrazine;Iproclozida |
| CAS: | 3544-35-2 |
| EINECS: | 222-589-5 |
| Molecular Formula: | C11H15 Cl N2 O2 |
| Molecular Weight: | 242.73 |
| InChI: | InChI=1/C11H15ClN2O2/c1-8(2)13-14-11(15)7-16-10-5-3-9(12)4-6-10/h3-6,8,13H,7H2,1-2H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | 157.3°C |
| Boiling Point: | 336.5°Cat760mmHg |
| Density: | 1.175g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
Iproclozide , its cas register number is 3544-35-2. It also can be called 1-(p-Chlorophenoxyacetyl)-2-isopropyl hydrazine ; p-Chlorophenoxyacetic acid 2-isopropylhydrazide ; (4-Chlorophenoxy)acetic acid 2-(1-methylethyl)hydrazide ; and Acetic acid, (4-chlorophenoxy)-, 2-(1-methylethyl)hydrazide (9CI) . It has since been discontinued, and has been known to cause fulminant hepatitis and there have been at least three reported fatalities due to administration of the drug. |
| Packinggroup: | III |
| Flash Point: | 157.3°C |
| Safety Data | |
 |
|
