| Identification | |
| Name: | 3-Piperidinol,1-methyl- |
| CAS: | 3554-74-3 |
| EINECS: | 222-609-2 |
| Molecular Formula: | C6H13 N O |
| Molecular Weight: | 115.17 |
| InChI: | InChI=1/C6H13NO/c1-7-4-2-3-6(8)5-7/h6,8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.999 |
| Refractive index: | 1.474 |
| Specification: |
3-Piperidinol,1-methyl- , its cas register number is 3554-74-3. It also can be called 1-Methyl-3-hydroxypiperidine ; 1-Methyl-3-piperidinol ; 3-Hydroxy-1-methylpiperidine ; 3-Hydroxy-N-methylpiperidine ; N-Methyl-3-hydroxypiperidine ; N-Methyl-3-piperidinol ; NSC 68348 . 3-Piperidinol,1-methyl- (CAS NO.3554-74-3) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
