| Identification | |
| Name: | Imazalil (1-[2-(2,4-Dichlorophenyl)-2-(2-propenyloxy)ethyl]1H-imidazole) |
| Synonyms: | 1-[2-(2,4-Dichloro-phenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole; 1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole |
| CAS: | 35554-44-0 |
| EINECS: | 252-615-0 |
| Molecular Formula: | C14H14Cl2N2O |
| Molecular Weight: | 297.2 |
| InChI: | InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 |
| Molecular Structure: | ![(C14H14Cl2N2O) 1-[2-(2,4-Dichloro-phenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole; 1-[2-(Allyloxy)-2-(2,4-dichlorophen...](https://img1.guidechem.com/structure/image/35554-44-0.jpg) |
| Properties | |
| Transport: | UN 2588 |
| Melting Point: | 52.7 oC |
| Boiling Point: | >340 oC |
| Density: | 1.348 |
| Stability: | Chemical stable at room temperature and absence of light. |
| Refractive index: | 1.5609 (20 C) |
| Water Solubility: | 0.018 G/100 ML |
| Solubility: | 0.018 g/100 mL |
| Appearance: | Slightly yellow to brown liquid with a characteristic odor. A solution in methanol. |
| Specification: |
Storage: Store in a cool dry area away from excessive heat and naked flame. Store in an area designed specifically for pesticides. |
| Packinggroup: | III |
| Storage Temperature: | Store in an area designed specifically for pesticides. Do not store near food, feedstuffs, fertilizers or seeds. Do not countermine water, food or feed by storage or disposal. Store in a cool dry area away from excessive heat and naked flame. Keep out of reach of children. |
| Color: | Slightly yellow to brown crystalline mass. Solidified oil Brownish oil |
| Usage: | Fungicide for postharvest treatment of citrus. |
| Safety Data | |
 |
|
