| Identification | |
| Name: | Propane,3-chloro-1,1-diethoxy- |
| Synonyms: | Propionaldehyde,3-chloro-, diethyl acetal (6CI,7CI);1-Chloro-3,3-diethoxypropane;3,3-Diethoxypropyl chloride;3-Chloropropanaldiethyl acetal;3-Chloropropionaldehyde diethyl acetal;NSC 60136;b-Chloropropanal diethyl acetal;b-Chloropropionaldehyde diethylacetal; |
| CAS: | 35573-93-4 |
| EINECS: | 252-623-4 |
| Molecular Formula: | C7H15ClO2 |
| Molecular Weight: | 166.65 |
| InChI: | InChI=1/C7H15ClO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 |
| Density: | 0.995 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.420 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. |
| Specification: |
Propane,3-chloro-1,1-diethoxy- (CAS NO.35573-93-4) is also named as 3-Chloro-1,1-diethoxypropane ; 1-Chloro-3,3-diethoxypropane ; 3-Chloropropanal diethyl acetal ; 3-Chloropropionaldehyde Diethyl Acetal ; 3-Chloropropionaldehyde Diethyl Acetal (stabilized with Copper chip) . Propane,3-chloro-1,1-diethoxy- (CAS NO.35573-93-4) is clear colourless to yellow liquid. It ia insoluble in water, soluble in alcohol, ether. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
