| Identification | |
| Name: | 2(1H)-Pyridinone,1-(2-aminoethyl)- |
| Synonyms: | 1-(2-aminoethyl)pyridin-2(1H)-one |
| CAS: | 35597-92-3 |
| Molecular Formula: | C7H10N2O |
| Molecular Weight: | 138.17 |
| InChI: | InChI=1/C7H10N2O/c8-4-6-9-5-2-1-3-7(9)10/h1-3,5H,4,6,8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.133 |
| Refractive index: | 1.55 |
| Specification: |
The cas register number of 1-(2-Aminoethyl)pyridin-2(1H)-one is 35597-92-3. It also can be called as 2(1H)-Pyridinone, 1-(2-aminoethyl)- and the Systematic name about this chemical is 1-(2-aminoethyl)pyridin-2-one. Physical properties about 1-(2-Aminoethyl)pyridin-2(1H)-one are: storage temp: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 1.05; (5)#H bond acceptors: 3; (6)#H bond donors: 2; (7)#Freely Rotating Bonds: 3; (8)Polar Surface Area: 46.33Å2; (9)Index of Refraction: 1.55; (10)Molar Refractivity: 38.82 cm3; (11)Molar Volume: 121.8 cm3; (12)Surface Tension: 45.9 dyne/cm; (13)Density: 1.133 g/cm3; (14)Flash Point: 157.9 °C; (15)Enthalpy of Vaporization: 58.08 kJ/mol; (16)Boiling Point: 337.5 °C at 760 mmHg; (17)Vapour Pressure: 0.000104 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
