| Identification | |
| Name: | Zylofuramine |
| Synonyms: | Furfurylamine,a-benzyl-N-ethyltetrahydro-,D-threo- (8CI); D-threo-a-Benzyl-N-ethyltetrahydrofurfurylamine;Zylofuraminum |
| CAS: | 3563-92-6 |
| Molecular Formula: | C14H21 N O |
| Molecular Weight: | 219.36 |
| InChI: | InChI=1/C14H21NO/c1-2-15-13(14-9-6-10-16-14)11-12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3/t13-,14-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.2°C |
| Boiling Point: | 328.8°Cat760mmHg |
| Density: | 1.006g/cm3 |
| Refractive index: | 1.523 |
| Specification: |
Zylofuramine ,its cas register number is 3563-92-6. It also can be called D-threo-alpha-Benzyl-N-ethyltetrahydrofurfurylamine ; Furfurylamine, alpha-benzyl-N-ethyl-tetrahydro-, D-threo- ; and Zylofuraminum . Zylofuramine (CAS NO.3563-92-6) is legal throughout the world. Its chemical structure has a vague similarity to other N-ethyl substituted stimulant drugs such as ethylamphetamine. |
| Flash Point: | 137.2°C |
| Safety Data | |
 |
|
