Identification |
Name: | 8-Quinolinol,5-nitroso- |
Synonyms: | 5-Nitroso-8-hydroxyquinoline;5-Nitroso-8-quinolinol; 5-Nitrosooxine; 8-Hydroxy-5-nitrosoquinoline; HydronIII; NSC 3852 |
CAS: | 3565-26-2 |
EINECS: | 222-650-6 |
Molecular Formula: | C9H6 N2 O2 |
Molecular Weight: | 174.17 |
InChI: | InChI=1/C9H6N2O2/c12-8-4-3-7(11-13)6-2-1-5-10-9(6)8/h1-5,12H |
Molecular Structure: |
 |
Properties |
Melting Point: | 245 °C
|
Flash Point: | 197.7°C |
Boiling Point: | 403.3°Cat760mmHg |
Density: | 1.4g/cm3 |
Refractive index: | 1.675 |
Biological Activity: | Histone deacetylase inhibitor. Causes cell differentiation and antiproliferative activity in MCF-7 human breast cancer cells in vitro and displays antitumor activity in vivo . |
Flash Point: | 197.7°C |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
 |