| Identification |
| Name: | Benzoyl chloride,2,5-difluoro- |
| Synonyms: | 2,5-Difluorobenzoylchloride;2,5-Difluorobenzoyl chloride; |
| CAS: | 35730-09-7 |
| EINECS: | 252-701-8 |
| Molecular Formula: | C7H3ClF2O |
| Molecular Weight: | 176.55 |
| InChI: | InChI=1/C7H3ClF2O/c8-7(11)5-3-4(9)1-2-6(5)10/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Density: | 1.425 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.514-1.516 |
| Appearance: | clear colorless liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
