| Identification | |
| Name: | b-D-Glucopyranosiduronic acid,1H-indol-3-yl |
| Synonyms: | 3-Indolyl-b-D-glucuronide; Indol-3-yl b-D-glucosiduronic acid; Indolyl3-glucuronide; Indoxyl b-D-glucuronide |
| CAS: | 35804-66-1 |
| Molecular Formula: | C14H15 N O7 |
| Molecular Weight: | 309.2714 |
| InChI: | InChI=1S/C14H15NO7/c16-9-10(17)12(13(19)20)22-14(11(9)18)21-8-5-15-7-4-2-1-3-6(7)8/h1-5,9-12,14-18H,(H,19,20)/t9-,10-,11+,12-,14+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 358.4°C |
| Boiling Point: | 669°Cat760mmHg |
| Density: | 1.693g/cm3 |
| Water Solubility: | Soluble in water Soluble methanol and acetone |
| Solubility: | Soluble in water Soluble methanol and acetone |
| Appearance: | White to off-white crystalline powder |
| Specification: |
beta-D-Glucopyranosiduronic acid,1H-indol-3-yl , its CAS NO. is 35804-66-1, the synonyms are 3-Indoxyl-beta-D-glucuronic acid cyclohexylammonium salt ; 3-Indoxyl-beta-D-glucuronide cyclohexylammonium salt . |
| Flash Point: | 358.4°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
